C28H21N3O5 — CID 1281060
[2-methoxy-4-[[2-(4-methylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenyl] furan-2-carboxylate (PubChem CID 1281060) has the molecular formula C28H21N3O5 and a molecular weight of 479.49 g/mol. Its IUPAC name is [2-methoxy-4-[[2-(4-methylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenyl] furan-2-carboxylate.
| Compound Name | [2-methoxy-4-[[2-(4-methylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 1281060 |
| Molecular Formula | C28H21N3O5 |
| Molecular Weight | 479.49 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | [2-methoxy-4-[[2-(4-methylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]phenyl] furan-2-carboxylate |
| SMILES | COc1cc(C=Nn2c(-c3ccc(C)cc3)nc3ccccc3c2=O)ccc1OC(=O)c1ccco1 |
| InChI | InChI=1S/C28H21N3O5/c1-18-9-12-20(13-10-18)26-30-22-7-4-3-6-21(22)27(32)31(26)29-17-19-11-14-23(25(16-19)34-2)36-28(33)24-8-5-15-35-24/h3-17H,1-2H3 |
| InChIKey | ZNQFPLIQMFBSII-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 95.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.49 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|