C16H15ClN6O2 — CID 1285947
1-[(3-chloro-5-methoxy-4-phenylmethoxyphenyl)methylideneamino]tetrazol-5-amine (PubChem CID 1285947) has the molecular formula C16H15ClN6O2 and a molecular weight of 358.79 g/mol. Its IUPAC name is 1-[(3-chloro-5-methoxy-4-phenylmethoxyphenyl)methylideneamino]tetrazol-5-amine.
| Compound Name | 1-[(3-chloro-5-methoxy-4-phenylmethoxyphenyl)methylideneamino]tetrazol-5-amine |
|---|---|
| PubChem CID | 1285947 |
| Molecular Formula | C16H15ClN6O2 |
| Molecular Weight | 358.79 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | 1-[(3-chloro-5-methoxy-4-phenylmethoxyphenyl)methylideneamino]tetrazol-5-amine |
| SMILES | COc1cc(C=Nn2nnnc2N)cc(Cl)c1OCc1ccccc1 |
| InChI | InChI=1S/C16H15ClN6O2/c1-24-14-8-12(9-19-23-16(18)20-21-22-23)7-13(17)15(14)25-10-11-5-3-2-4-6-11/h2-9H,10H2,1H3,(H2,18,20,22) |
| InChIKey | GOWITFZPSLUUIF-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.79 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|