C17H18N6O3 — CID 1224695
N-phenyl-1-[(3,4,5-trimethoxyphenyl)methylideneamino]tetrazol-5-amine (PubChem CID 1224695) has the molecular formula C17H18N6O3 and a molecular weight of 354.37 g/mol. Its IUPAC name is N-phenyl-1-[(3,4,5-trimethoxyphenyl)methylideneamino]tetrazol-5-amine.
| Compound Name | N-phenyl-1-[(3,4,5-trimethoxyphenyl)methylideneamino]tetrazol-5-amine |
|---|---|
| PubChem CID | 1224695 |
| Molecular Formula | C17H18N6O3 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | N-phenyl-1-[(3,4,5-trimethoxyphenyl)methylideneamino]tetrazol-5-amine |
| SMILES | COc1cc(C=Nn2nnnc2Nc2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C17H18N6O3/c1-24-14-9-12(10-15(25-2)16(14)26-3)11-18-23-17(20-21-22-23)19-13-7-5-4-6-8-13/h4-11H,1-3H3,(H,19,20,22) |
| InChIKey | YXIYBCGMIIPAHZ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 95.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|