C15H14N6O2 — CID 135951033
2-[(E)-(5-anilinotetrazol-1-yl)iminomethyl]-6-methoxyphenol (PubChem CID 135951033) has the molecular formula C15H14N6O2 and a molecular weight of 310.32 g/mol. Its IUPAC name is 2-[(E)-(5-anilinotetrazol-1-yl)iminomethyl]-6-methoxyphenol.
| Compound Name | 2-[(E)-(5-anilinotetrazol-1-yl)iminomethyl]-6-methoxyphenol |
|---|---|
| PubChem CID | 135951033 |
| Molecular Formula | C15H14N6O2 |
| Molecular Weight | 310.32 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 2-[(E)-(5-anilinotetrazol-1-yl)iminomethyl]-6-methoxyphenol |
| SMILES | COc1cccc(/C=N/n2nnnc2Nc2ccccc2)c1O |
| InChI | InChI=1S/C15H14N6O2/c1-23-13-9-5-6-11(14(13)22)10-16-21-15(18-19-20-21)17-12-7-3-2-4-8-12/h2-10,22H,1H3,(H,17,18,20)/b16-10+ |
| InChIKey | JBWOVZHUJQKSCW-MHWRWJLKSA-N |
| XLogP | 2.01 |
| TPSA | 97.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.32 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|