C20H18N6O2 — CID 6164392
1-[(Z)-(3,4-dimethoxyphenyl)methylideneamino]-N-naphthalen-1-yltetrazol-5-amine (PubChem CID 6164392) has the molecular formula C20H18N6O2 and a molecular weight of 374.40 g/mol. Its IUPAC name is 1-[(Z)-(3,4-dimethoxyphenyl)methylideneamino]-N-naphthalen-1-yltetrazol-5-amine.
| Compound Name | 1-[(Z)-(3,4-dimethoxyphenyl)methylideneamino]-N-naphthalen-1-yltetrazol-5-amine |
|---|---|
| PubChem CID | 6164392 |
| Molecular Formula | C20H18N6O2 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 1-[(Z)-(3,4-dimethoxyphenyl)methylideneamino]-N-naphthalen-1-yltetrazol-5-amine |
| SMILES | COc1ccc(/C=N\n2nnnc2Nc2cccc3ccccc23)cc1OC |
| InChI | InChI=1S/C20H18N6O2/c1-27-18-11-10-14(12-19(18)28-2)13-21-26-20(23-24-25-26)22-17-9-5-7-15-6-3-4-8-16(15)17/h3-13H,1-2H3,(H,22,23,25)/b21-13- |
| InChIKey | DUFGFQQYJORPQQ-BKUYFWCQSA-N |
| XLogP | 3.47 |
| TPSA | 86.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|