C11H13N7O3 — CID 6858847
2-[4-[(E)-(5-aminotetrazol-1-yl)iminomethyl]-2-methoxyphenoxy]acetamide (PubChem CID 6858847) has the molecular formula C11H13N7O3 and a molecular weight of 291.27 g/mol. Its IUPAC name is 2-[4-[(E)-(5-aminotetrazol-1-yl)iminomethyl]-2-methoxyphenoxy]acetamide.
| Compound Name | 2-[4-[(E)-(5-aminotetrazol-1-yl)iminomethyl]-2-methoxyphenoxy]acetamide |
|---|---|
| PubChem CID | 6858847 |
| Molecular Formula | C11H13N7O3 |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 2-[4-[(E)-(5-aminotetrazol-1-yl)iminomethyl]-2-methoxyphenoxy]acetamide |
| SMILES | COc1cc(/C=N/n2nnnc2N)ccc1OCC(N)=O |
| InChI | InChI=1S/C11H13N7O3/c1-20-9-4-7(2-3-8(9)21-6-10(12)19)5-14-18-11(13)15-16-17-18/h2-5H,6H2,1H3,(H2,12,19)(H2,13,15,17)/b14-5+ |
| InChIKey | RTGIIHPVCONBBN-LHHJGKSTSA-N |
| XLogP | -0.99 |
| TPSA | 143.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|