C16H21N7O3 — CID 5455168
2-[2-[(Z)-(5-aminotetrazol-1-yl)iminomethyl]-6-methoxyphenoxy]-1-piperidin-1-ylethanone (PubChem CID 5455168) has the molecular formula C16H21N7O3 and a molecular weight of 359.39 g/mol. Its IUPAC name is 2-[2-[(Z)-(5-aminotetrazol-1-yl)iminomethyl]-6-methoxyphenoxy]-1-piperidin-1-ylethanone.
| Compound Name | 2-[2-[(Z)-(5-aminotetrazol-1-yl)iminomethyl]-6-methoxyphenoxy]-1-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 5455168 |
| Molecular Formula | C16H21N7O3 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 2-[2-[(Z)-(5-aminotetrazol-1-yl)iminomethyl]-6-methoxyphenoxy]-1-piperidin-1-ylethanone |
| SMILES | COc1cccc(/C=N\n2nnnc2N)c1OCC(=O)N1CCCCC1 |
| InChI | InChI=1S/C16H21N7O3/c1-25-13-7-5-6-12(10-18-23-16(17)19-20-21-23)15(13)26-11-14(24)22-8-3-2-4-9-22/h5-7,10H,2-4,8-9,11H2,1H3,(H2,17,19,21)/b18-10- |
| InChIKey | BHGNSUNFNVGRBX-ZDLGFXPLSA-N |
| XLogP | 0.54 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|