C12H10N6 — CID 3517889
1-(naphthalen-1-ylmethylideneamino)tetrazol-5-amine (PubChem CID 3517889) has the molecular formula C12H10N6 and a molecular weight of 238.25 g/mol. Its IUPAC name is 1-(naphthalen-1-ylmethylideneamino)tetrazol-5-amine.
| Compound Name | 1-(naphthalen-1-ylmethylideneamino)tetrazol-5-amine |
|---|---|
| PubChem CID | 3517889 |
| Molecular Formula | C12H10N6 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 1-(naphthalen-1-ylmethylideneamino)tetrazol-5-amine |
| SMILES | Nc1nnnn1N=Cc1cccc2ccccc12 |
| InChI | InChI=1S/C12H10N6/c13-12-15-16-17-18(12)14-8-10-6-3-5-9-4-1-2-7-11(9)10/h1-8H,(H2,13,15,17) |
| InChIKey | YDGKBZFVLQKBPR-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 81.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|