C36H24N6 — CID 22086741
(E)-N-[4,6-bis[(E)-naphthalen-1-ylmethylideneamino]-1,3,5-triazin-2-yl]-1-naphthalen-1-ylmethanimine (PubChem CID 22086741) has the molecular formula C36H24N6 and a molecular weight of 540.63 g/mol. Its IUPAC name is (E)-N-[4,6-bis[(E)-naphthalen-1-ylmethylideneamino]-1,3,5-triazin-2-yl]-1-naphthalen-1-ylmethanimine.
| Compound Name | (E)-N-[4,6-bis[(E)-naphthalen-1-ylmethylideneamino]-1,3,5-triazin-2-yl]-1-naphthalen-1-ylmethanimine |
|---|---|
| PubChem CID | 22086741 |
| Molecular Formula | C36H24N6 |
| Molecular Weight | 540.63 g/mol |
| Exact Mass | 540.21 |
| IUPAC Name | (E)-N-[4,6-bis[(E)-naphthalen-1-ylmethylideneamino]-1,3,5-triazin-2-yl]-1-naphthalen-1-ylmethanimine |
| SMILES | C(=N/c1nc(/N=C/c2cccc3ccccc23)nc(/N=C/c2cccc3ccccc23)n1)\c1cccc2ccccc12 |
| InChI | InChI=1S/C36H24N6/c1-4-19-31-25(10-1)13-7-16-28(31)22-37-34-40-35(38-23-29-17-8-14-26-11-2-5-20-32(26)29)42-36(41-34)39-24-30-18-9-15-27-12-3-6-21-33(27)30/h1-24H/b37-22+,38-23+,39-24+ |
| InChIKey | GACRXIRHGYBDJM-ZLTZTYTLSA-N |
| XLogP | 8.58 |
| TPSA | 75.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.63 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|