C17H11Br2N — CID 21210393
N-(2,4-dibromophenyl)-1-naphthalen-1-ylmethanimine (PubChem CID 21210393) has the molecular formula C17H11Br2N and a molecular weight of 389.09 g/mol. Its IUPAC name is N-(2,4-dibromophenyl)-1-naphthalen-1-ylmethanimine.
| Compound Name | N-(2,4-dibromophenyl)-1-naphthalen-1-ylmethanimine |
|---|---|
| PubChem CID | 21210393 |
| Molecular Formula | C17H11Br2N |
| Molecular Weight | 389.09 g/mol |
| Exact Mass | 386.93 |
| IUPAC Name | N-(2,4-dibromophenyl)-1-naphthalen-1-ylmethanimine |
| SMILES | Brc1ccc(/N=C/c2cccc3ccccc23)c(Br)c1 |
| InChI | InChI=1S/C17H11Br2N/c18-14-8-9-17(16(19)10-14)20-11-13-6-3-5-12-4-1-2-7-15(12)13/h1-11H/b20-11+ |
| InChIKey | ITPRLZWCKBHXSI-RGVLZGJSSA-N |
| XLogP | 6.12 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.09 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|