C14H17N7O3 — CID 5426901
2-[2-[(Z)-(5-aminotetrazol-1-yl)iminomethyl]phenoxy]-1-morpholin-4-ylethanone (PubChem CID 5426901) has the molecular formula C14H17N7O3 and a molecular weight of 331.34 g/mol. Its IUPAC name is 2-[2-[(Z)-(5-aminotetrazol-1-yl)iminomethyl]phenoxy]-1-morpholin-4-ylethanone.
| Compound Name | 2-[2-[(Z)-(5-aminotetrazol-1-yl)iminomethyl]phenoxy]-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 5426901 |
| Molecular Formula | C14H17N7O3 |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 2-[2-[(Z)-(5-aminotetrazol-1-yl)iminomethyl]phenoxy]-1-morpholin-4-ylethanone |
| SMILES | Nc1nnnn1/N=C\c1ccccc1OCC(=O)N1CCOCC1 |
| InChI | InChI=1S/C14H17N7O3/c15-14-17-18-19-21(14)16-9-11-3-1-2-4-12(11)24-10-13(22)20-5-7-23-8-6-20/h1-4,9H,5-8,10H2,(H2,15,17,19)/b16-9- |
| InChIKey | LXXDYZFGDVEWQN-SXGWCWSVSA-N |
| XLogP | -0.62 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|