C11H14N6O — CID 21214124
1-[(2-propoxyphenyl)methylideneamino]tetrazol-5-amine (PubChem CID 21214124) has the molecular formula C11H14N6O and a molecular weight of 246.27 g/mol. Its IUPAC name is 1-[(2-propoxyphenyl)methylideneamino]tetrazol-5-amine.
| Compound Name | 1-[(2-propoxyphenyl)methylideneamino]tetrazol-5-amine |
|---|---|
| PubChem CID | 21214124 |
| Molecular Formula | C11H14N6O |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 1-[(2-propoxyphenyl)methylideneamino]tetrazol-5-amine |
| SMILES | CCCOc1ccccc1C=Nn1nnnc1N |
| InChI | InChI=1S/C11H14N6O/c1-2-7-18-10-6-4-3-5-9(10)8-13-17-11(12)14-15-16-17/h3-6,8H,2,7H2,1H3,(H2,12,14,16) |
| InChIKey | XGRVSQXSHPVVEP-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 91.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|