C13H17BrN6O2 — CID 6114126
1-[(Z)-(3-bromo-5-ethoxy-4-propoxyphenyl)methylideneamino]tetrazol-5-amine (PubChem CID 6114126) has the molecular formula C13H17BrN6O2 and a molecular weight of 369.22 g/mol. Its IUPAC name is 1-[(Z)-(3-bromo-5-ethoxy-4-propoxyphenyl)methylideneamino]tetrazol-5-amine.
| Compound Name | 1-[(Z)-(3-bromo-5-ethoxy-4-propoxyphenyl)methylideneamino]tetrazol-5-amine |
|---|---|
| PubChem CID | 6114126 |
| Molecular Formula | C13H17BrN6O2 |
| Molecular Weight | 369.22 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | 1-[(Z)-(3-bromo-5-ethoxy-4-propoxyphenyl)methylideneamino]tetrazol-5-amine |
| SMILES | CCCOc1c(Br)cc(/C=N\n2nnnc2N)cc1OCC |
| InChI | InChI=1S/C13H17BrN6O2/c1-3-5-22-12-10(14)6-9(7-11(12)21-4-2)8-16-20-13(15)17-18-19-20/h6-8H,3-5H2,1-2H3,(H2,15,17,19)/b16-8- |
| InChIKey | PDXREIRENSWPFC-PXNMLYILSA-N |
| XLogP | 2.09 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.22 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|