C13H14N4O4 — CID 5344281
methyl 2-[2-methoxy-4-[(E)-1,2,4-triazol-4-yliminomethyl]phenoxy]acetate (PubChem CID 5344281) has the molecular formula C13H14N4O4 and a molecular weight of 290.28 g/mol. Its IUPAC name is methyl 2-[2-methoxy-4-[(E)-1,2,4-triazol-4-yliminomethyl]phenoxy]acetate.
| Compound Name | methyl 2-[2-methoxy-4-[(E)-1,2,4-triazol-4-yliminomethyl]phenoxy]acetate |
|---|---|
| PubChem CID | 5344281 |
| Molecular Formula | C13H14N4O4 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | methyl 2-[2-methoxy-4-[(E)-1,2,4-triazol-4-yliminomethyl]phenoxy]acetate |
| SMILES | COC(=O)COc1ccc(/C=N/n2cnnc2)cc1OC |
| InChI | InChI=1S/C13H14N4O4/c1-19-12-5-10(6-16-17-8-14-15-9-17)3-4-11(12)21-7-13(18)20-2/h3-6,8-9H,7H2,1-2H3/b16-6+ |
| InChIKey | NGVSYSVPWYBUHA-OMCISZLKSA-N |
| XLogP | 0.72 |
| TPSA | 87.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|