C10H9ClN4O — CID 4535842
1-(3-chloro-4-methoxyphenyl)-N-(1,2,4-triazol-4-yl)methanimine (PubChem CID 4535842) has the molecular formula C10H9ClN4O and a molecular weight of 236.66 g/mol. Its IUPAC name is 1-(3-chloro-4-methoxyphenyl)-N-(1,2,4-triazol-4-yl)methanimine.
| Compound Name | 1-(3-chloro-4-methoxyphenyl)-N-(1,2,4-triazol-4-yl)methanimine |
|---|---|
| PubChem CID | 4535842 |
| Molecular Formula | C10H9ClN4O |
| Molecular Weight | 236.66 g/mol |
| Exact Mass | 236.05 |
| IUPAC Name | 1-(3-chloro-4-methoxyphenyl)-N-(1,2,4-triazol-4-yl)methanimine |
| SMILES | COc1ccc(C=Nn2cnnc2)cc1Cl |
| InChI | InChI=1S/C10H9ClN4O/c1-16-10-3-2-8(4-9(10)11)5-14-15-6-12-13-7-15/h2-7H,1H3 |
| InChIKey | JZGIGXPEVHAQCL-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 52.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.66 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|