C18H13BrN6 — CID 5499247
1-[(Z)-(3-bromophenyl)methylideneamino]-N-naphthalen-1-yltetrazol-5-amine (PubChem CID 5499247) has the molecular formula C18H13BrN6 and a molecular weight of 393.25 g/mol. Its IUPAC name is 1-[(Z)-(3-bromophenyl)methylideneamino]-N-naphthalen-1-yltetrazol-5-amine.
| Compound Name | 1-[(Z)-(3-bromophenyl)methylideneamino]-N-naphthalen-1-yltetrazol-5-amine |
|---|---|
| PubChem CID | 5499247 |
| Molecular Formula | C18H13BrN6 |
| Molecular Weight | 393.25 g/mol |
| Exact Mass | 392.04 |
| IUPAC Name | 1-[(Z)-(3-bromophenyl)methylideneamino]-N-naphthalen-1-yltetrazol-5-amine |
| SMILES | Brc1cccc(/C=N\n2nnnc2Nc2cccc3ccccc23)c1 |
| InChI | InChI=1S/C18H13BrN6/c19-15-8-3-5-13(11-15)12-20-25-18(22-23-24-25)21-17-10-4-7-14-6-1-2-9-16(14)17/h1-12H,(H,21,22,24)/b20-12- |
| InChIKey | SWLIQPPQJQKSOE-NDENLUEZSA-N |
| XLogP | 4.21 |
| TPSA | 67.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.25 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|