C16H15BrN6O2 — CID 23877559
1-[(5-bromo-2,4-dimethoxyphenyl)methylideneamino]-N-phenyltetrazol-5-amine (PubChem CID 23877559) has the molecular formula C16H15BrN6O2 and a molecular weight of 403.24 g/mol. Its IUPAC name is 1-[(5-bromo-2,4-dimethoxyphenyl)methylideneamino]-N-phenyltetrazol-5-amine.
| Compound Name | 1-[(5-bromo-2,4-dimethoxyphenyl)methylideneamino]-N-phenyltetrazol-5-amine |
|---|---|
| PubChem CID | 23877559 |
| Molecular Formula | C16H15BrN6O2 |
| Molecular Weight | 403.24 g/mol |
| Exact Mass | 402.04 |
| IUPAC Name | 1-[(5-bromo-2,4-dimethoxyphenyl)methylideneamino]-N-phenyltetrazol-5-amine |
| SMILES | COc1cc(OC)c(C=Nn2nnnc2Nc2ccccc2)cc1Br |
| InChI | InChI=1S/C16H15BrN6O2/c1-24-14-9-15(25-2)13(17)8-11(14)10-18-23-16(20-21-22-23)19-12-6-4-3-5-7-12/h3-10H,1-2H3,(H,19,20,22) |
| InChIKey | BERCAVFKLDOJSP-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 86.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.24 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|