C16H10Cl2N2O2 — CID 748300
(4Z)-4-benzylidene-1-(3,4-dichlorophenyl)pyrazolidine-3,5-dione (PubChem CID 748300) has the molecular formula C16H10Cl2N2O2 and a molecular weight of 333.17 g/mol. Its IUPAC name is (4Z)-4-benzylidene-1-(3,4-dichlorophenyl)pyrazolidine-3,5-dione.
| Compound Name | (4Z)-4-benzylidene-1-(3,4-dichlorophenyl)pyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 748300 |
| Molecular Formula | C16H10Cl2N2O2 |
| Molecular Weight | 333.17 g/mol |
| Exact Mass | 332.01 |
| IUPAC Name | (4Z)-4-benzylidene-1-(3,4-dichlorophenyl)pyrazolidine-3,5-dione |
| SMILES | O=C1NN(c2ccc(Cl)c(Cl)c2)C(=O)/C1=C\c1ccccc1 |
| InChI | InChI=1S/C16H10Cl2N2O2/c17-13-7-6-11(9-14(13)18)20-16(22)12(15(21)19-20)8-10-4-2-1-3-5-10/h1-9H,(H,19,21)/b12-8- |
| InChIKey | PAYSDIVTEWDIFN-WQLSENKSSA-N |
| XLogP | 3.45 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.17 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|