C18H13Cl3N2O4 — CID 1270544
(4Z)-4-[(3-chloro-4,5-dimethoxyphenyl)methylidene]-1-(3,4-dichlorophenyl)pyrazolidine-3,5-dione (PubChem CID 1270544) has the molecular formula C18H13Cl3N2O4 and a molecular weight of 427.67 g/mol. Its IUPAC name is (4Z)-4-[(3-chloro-4,5-dimethoxyphenyl)methylidene]-1-(3,4-dichlorophenyl)pyrazolidine-3,5-dione.
| Compound Name | (4Z)-4-[(3-chloro-4,5-dimethoxyphenyl)methylidene]-1-(3,4-dichlorophenyl)pyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 1270544 |
| Molecular Formula | C18H13Cl3N2O4 |
| Molecular Weight | 427.67 g/mol |
| Exact Mass | 425.99 |
| IUPAC Name | (4Z)-4-[(3-chloro-4,5-dimethoxyphenyl)methylidene]-1-(3,4-dichlorophenyl)pyrazolidine-3,5-dione |
| SMILES | COc1cc(/C=C2/C(=O)NN(c3ccc(Cl)c(Cl)c3)C2=O)cc(Cl)c1OC |
| InChI | InChI=1S/C18H13Cl3N2O4/c1-26-15-7-9(6-14(21)16(15)27-2)5-11-17(24)22-23(18(11)25)10-3-4-12(19)13(20)8-10/h3-8H,1-2H3,(H,22,24)/b11-5- |
| InChIKey | ATYPXBXHSKMKIC-WZUFQYTHSA-N |
| XLogP | 4.13 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.67 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|