C15H9Cl2N3O2 — CID 71835127
1-(3,4-dichlorophenyl)-4-(pyridin-4-ylmethylidene)pyrazolidine-3,5-dione (PubChem CID 71835127) has the molecular formula C15H9Cl2N3O2 and a molecular weight of 334.16 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-4-(pyridin-4-ylmethylidene)pyrazolidine-3,5-dione.
| Compound Name | 1-(3,4-dichlorophenyl)-4-(pyridin-4-ylmethylidene)pyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 71835127 |
| Molecular Formula | C15H9Cl2N3O2 |
| Molecular Weight | 334.16 g/mol |
| Exact Mass | 333.01 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-4-(pyridin-4-ylmethylidene)pyrazolidine-3,5-dione |
| SMILES | O=C1NN(c2ccc(Cl)c(Cl)c2)C(=O)C1=Cc1ccncc1 |
| InChI | InChI=1S/C15H9Cl2N3O2/c16-12-2-1-10(8-13(12)17)20-15(22)11(14(21)19-20)7-9-3-5-18-6-4-9/h1-8H,(H,19,21) |
| InChIKey | ZRPUSPIAPSSYNJ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.16 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|