C17H10Cl2N2O3 — CID 1021434
4-[(E)-[1-(3,4-dichlorophenyl)-3,5-dioxopyrazolidin-4-ylidene]methyl]benzaldehyde (PubChem CID 1021434) has the molecular formula C17H10Cl2N2O3 and a molecular weight of 361.18 g/mol. Its IUPAC name is 4-[(E)-[1-(3,4-dichlorophenyl)-3,5-dioxopyrazolidin-4-ylidene]methyl]benzaldehyde.
| Compound Name | 4-[(E)-[1-(3,4-dichlorophenyl)-3,5-dioxopyrazolidin-4-ylidene]methyl]benzaldehyde |
|---|---|
| PubChem CID | 1021434 |
| Molecular Formula | C17H10Cl2N2O3 |
| Molecular Weight | 361.18 g/mol |
| Exact Mass | 360.01 |
| IUPAC Name | 4-[(E)-[1-(3,4-dichlorophenyl)-3,5-dioxopyrazolidin-4-ylidene]methyl]benzaldehyde |
| SMILES | O=Cc1ccc(/C=C2\C(=O)NN(c3ccc(Cl)c(Cl)c3)C2=O)cc1 |
| InChI | InChI=1S/C17H10Cl2N2O3/c18-14-6-5-12(8-15(14)19)21-17(24)13(16(23)20-21)7-10-1-3-11(9-22)4-2-10/h1-9H,(H,20,23)/b13-7+ |
| InChIKey | LMNWEDHNXYHLOH-NTUHNPAUSA-N |
| XLogP | 3.27 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.18 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|