C15H10Cl2N2O2S — CID 1365354
(4E)-1-(3,4-dichlorophenyl)-4-[(5-methylthiophen-2-yl)methylidene]pyrazolidine-3,5-dione (PubChem CID 1365354) has the molecular formula C15H10Cl2N2O2S and a molecular weight of 353.23 g/mol. Its IUPAC name is (4E)-1-(3,4-dichlorophenyl)-4-[(5-methylthiophen-2-yl)methylidene]pyrazolidine-3,5-dione.
| Compound Name | (4E)-1-(3,4-dichlorophenyl)-4-[(5-methylthiophen-2-yl)methylidene]pyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 1365354 |
| Molecular Formula | C15H10Cl2N2O2S |
| Molecular Weight | 353.23 g/mol |
| Exact Mass | 351.98 |
| IUPAC Name | (4E)-1-(3,4-dichlorophenyl)-4-[(5-methylthiophen-2-yl)methylidene]pyrazolidine-3,5-dione |
| SMILES | Cc1ccc(/C=C2\C(=O)NN(c3ccc(Cl)c(Cl)c3)C2=O)s1 |
| InChI | InChI=1S/C15H10Cl2N2O2S/c1-8-2-4-10(22-8)7-11-14(20)18-19(15(11)21)9-3-5-12(16)13(17)6-9/h2-7H,1H3,(H,18,20)/b11-7+ |
| InChIKey | GESVGTIZNIGVOH-YRNVUSSQSA-N |
| XLogP | 3.82 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.23 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|