C19H16Cl2N2O4 — CID 5212772
1-(3,4-dichlorophenyl)-4-[(2-ethoxy-3-methoxyphenyl)methylidene]pyrazolidine-3,5-dione (PubChem CID 5212772) has the molecular formula C19H16Cl2N2O4 and a molecular weight of 407.25 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-4-[(2-ethoxy-3-methoxyphenyl)methylidene]pyrazolidine-3,5-dione.
| Compound Name | 1-(3,4-dichlorophenyl)-4-[(2-ethoxy-3-methoxyphenyl)methylidene]pyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 5212772 |
| Molecular Formula | C19H16Cl2N2O4 |
| Molecular Weight | 407.25 g/mol |
| Exact Mass | 406.05 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-4-[(2-ethoxy-3-methoxyphenyl)methylidene]pyrazolidine-3,5-dione |
| SMILES | CCOc1c(C=C2C(=O)NN(c3ccc(Cl)c(Cl)c3)C2=O)cccc1OC |
| InChI | InChI=1S/C19H16Cl2N2O4/c1-3-27-17-11(5-4-6-16(17)26-2)9-13-18(24)22-23(19(13)25)12-7-8-14(20)15(21)10-12/h4-10H,3H2,1-2H3,(H,22,24) |
| InChIKey | VYRFGNSFUQKDDO-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.25 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|