C16H9Cl2N3O5 — CID 1104469
1-(3,4-dichlorophenyl)-4-[(2-hydroxy-5-nitrophenyl)methylidene]pyrazolidine-3,5-dione (PubChem CID 1104469) has the molecular formula C16H9Cl2N3O5 and a molecular weight of 394.17 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-4-[(2-hydroxy-5-nitrophenyl)methylidene]pyrazolidine-3,5-dione.
| Compound Name | 1-(3,4-dichlorophenyl)-4-[(2-hydroxy-5-nitrophenyl)methylidene]pyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 1104469 |
| Molecular Formula | C16H9Cl2N3O5 |
| Molecular Weight | 394.17 g/mol |
| Exact Mass | 392.99 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-4-[(2-hydroxy-5-nitrophenyl)methylidene]pyrazolidine-3,5-dione |
| SMILES | O=C1NN(c2ccc(Cl)c(Cl)c2)C(=O)C1=Cc1cc([N+](=O)[O-])ccc1O |
| InChI | InChI=1S/C16H9Cl2N3O5/c17-12-3-1-9(7-13(12)18)20-16(24)11(15(23)19-20)6-8-5-10(21(25)26)2-4-14(8)22/h1-7,22H,(H,19,23) |
| InChIKey | CXWUJOWYOUFCBJ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 112.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.17 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|