C23H14ClN3O6 — CID 3503707
[2-[(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]-4-nitrophenyl] 2-chlorobenzoate (PubChem CID 3503707) has the molecular formula C23H14ClN3O6 and a molecular weight of 463.83 g/mol. Its IUPAC name is [2-[(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]-4-nitrophenyl] 2-chlorobenzoate.
| Compound Name | [2-[(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]-4-nitrophenyl] 2-chlorobenzoate |
|---|---|
| PubChem CID | 3503707 |
| Molecular Formula | C23H14ClN3O6 |
| Molecular Weight | 463.83 g/mol |
| Exact Mass | 463.06 |
| IUPAC Name | [2-[(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]-4-nitrophenyl] 2-chlorobenzoate |
| SMILES | O=C1NN(c2ccccc2)C(=O)C1=Cc1cc([N+](=O)[O-])ccc1OC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C23H14ClN3O6/c24-19-9-5-4-8-17(19)23(30)33-20-11-10-16(27(31)32)12-14(20)13-18-21(28)25-26(22(18)29)15-6-2-1-3-7-15/h1-13H,(H,25,28) |
| InChIKey | GQGFHKBQUNIRSE-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.83 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|