C23H15Br2N3O5 — CID 126403991
(4Z)-4-[[2-[(2,4-dibromophenyl)methoxy]-5-nitrophenyl]methylidene]-1-phenylpyrazolidine-3,5-dione (PubChem CID 126403991) has the molecular formula C23H15Br2N3O5 and a molecular weight of 573.20 g/mol. Its IUPAC name is (4Z)-4-[[2-[(2,4-dibromophenyl)methoxy]-5-nitrophenyl]methylidene]-1-phenylpyrazolidine-3,5-dione.
| Compound Name | (4Z)-4-[[2-[(2,4-dibromophenyl)methoxy]-5-nitrophenyl]methylidene]-1-phenylpyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 126403991 |
| Molecular Formula | C23H15Br2N3O5 |
| Molecular Weight | 573.20 g/mol |
| Exact Mass | 570.94 |
| IUPAC Name | (4Z)-4-[[2-[(2,4-dibromophenyl)methoxy]-5-nitrophenyl]methylidene]-1-phenylpyrazolidine-3,5-dione |
| SMILES | O=C1NN(c2ccccc2)C(=O)/C1=C\c1cc([N+](=O)[O-])ccc1OCc1ccc(Br)cc1Br |
| InChI | InChI=1S/C23H15Br2N3O5/c24-16-7-6-14(20(25)12-16)13-33-21-9-8-18(28(31)32)10-15(21)11-19-22(29)26-27(23(19)30)17-4-2-1-3-5-17/h1-12H,13H2,(H,26,29)/b19-11- |
| InChIKey | IRNDCMBLTGWSPM-ODLFYWEKSA-N |
| XLogP | 5.16 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.20 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|