C25H18Br4N2O4 — CID 126403400
(4Z)-4-[[2,3-dibromo-4-[(2,4-dibromophenyl)methoxy]-5-ethoxyphenyl]methylidene]-1-phenylpyrazolidine-3,5-dione (PubChem CID 126403400) has the molecular formula C25H18Br4N2O4 and a molecular weight of 730.04 g/mol. Its IUPAC name is (4Z)-4-[[2,3-dibromo-4-[(2,4-dibromophenyl)methoxy]-5-ethoxyphenyl]methylidene]-1-phenylpyrazolidine-3,5-dione.
| Compound Name | (4Z)-4-[[2,3-dibromo-4-[(2,4-dibromophenyl)methoxy]-5-ethoxyphenyl]methylidene]-1-phenylpyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 126403400 |
| Molecular Formula | C25H18Br4N2O4 |
| Molecular Weight | 730.04 g/mol |
| Exact Mass | 725.80 |
| IUPAC Name | (4Z)-4-[[2,3-dibromo-4-[(2,4-dibromophenyl)methoxy]-5-ethoxyphenyl]methylidene]-1-phenylpyrazolidine-3,5-dione |
| SMILES | CCOc1cc(/C=C2/C(=O)NN(c3ccccc3)C2=O)c(Br)c(Br)c1OCc1ccc(Br)cc1Br |
| InChI | InChI=1S/C25H18Br4N2O4/c1-2-34-20-11-15(10-18-24(32)30-31(25(18)33)17-6-4-3-5-7-17)21(28)22(29)23(20)35-13-14-8-9-16(26)12-19(14)27/h3-12H,2,13H2,1H3,(H,30,32)/b18-10- |
| InChIKey | FAKYSKJHVFYDOM-ZDLGFXPLSA-N |
| XLogP | 7.18 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.04 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|