C20H16Br2N2O5 — CID 126405095
[2,3-dibromo-4-[(Z)-(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]-6-ethoxyphenyl] acetate (PubChem CID 126405095) has the molecular formula C20H16Br2N2O5 and a molecular weight of 524.17 g/mol. Its IUPAC name is [2,3-dibromo-4-[(Z)-(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]-6-ethoxyphenyl] acetate.
| Compound Name | [2,3-dibromo-4-[(Z)-(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]-6-ethoxyphenyl] acetate |
|---|---|
| PubChem CID | 126405095 |
| Molecular Formula | C20H16Br2N2O5 |
| Molecular Weight | 524.17 g/mol |
| Exact Mass | 521.94 |
| IUPAC Name | [2,3-dibromo-4-[(Z)-(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]-6-ethoxyphenyl] acetate |
| SMILES | CCOc1cc(/C=C2/C(=O)NN(c3ccccc3)C2=O)c(Br)c(Br)c1OC(C)=O |
| InChI | InChI=1S/C20H16Br2N2O5/c1-3-28-15-10-12(16(21)17(22)18(15)29-11(2)25)9-14-19(26)23-24(20(14)27)13-7-5-4-6-8-13/h4-10H,3H2,1-2H3,(H,23,26)/b14-9- |
| InChIKey | TVTNWDCUMGXMGG-ZROIWOOFSA-N |
| XLogP | 4.00 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.17 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|