C20H17IN2O5 — CID 3953410
[4-[(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]-2-ethoxy-6-iodophenyl] acetate (PubChem CID 3953410) has the molecular formula C20H17IN2O5 and a molecular weight of 492.27 g/mol. Its IUPAC name is [4-[(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]-2-ethoxy-6-iodophenyl] acetate.
| Compound Name | [4-[(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]-2-ethoxy-6-iodophenyl] acetate |
|---|---|
| PubChem CID | 3953410 |
| Molecular Formula | C20H17IN2O5 |
| Molecular Weight | 492.27 g/mol |
| Exact Mass | 492.02 |
| IUPAC Name | [4-[(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]-2-ethoxy-6-iodophenyl] acetate |
| SMILES | CCOc1cc(C=C2C(=O)NN(c3ccccc3)C2=O)cc(I)c1OC(C)=O |
| InChI | InChI=1S/C20H17IN2O5/c1-3-27-17-11-13(10-16(21)18(17)28-12(2)24)9-15-19(25)22-23(20(15)26)14-7-5-4-6-8-14/h4-11H,3H2,1-2H3,(H,22,25) |
| InChIKey | BTKZSJDVUPADMA-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.27 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|