C23H16N2O4 — CID 6180451
[2-[(E)-(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]phenyl] benzoate (PubChem CID 6180451) has the molecular formula C23H16N2O4 and a molecular weight of 384.39 g/mol. Its IUPAC name is [2-[(E)-(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]phenyl] benzoate.
| Compound Name | [2-[(E)-(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]phenyl] benzoate |
|---|---|
| PubChem CID | 6180451 |
| Molecular Formula | C23H16N2O4 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | [2-[(E)-(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]phenyl] benzoate |
| SMILES | O=C1NN(c2ccccc2)C(=O)/C1=C/c1ccccc1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C23H16N2O4/c26-21-19(22(27)25(24-21)18-12-5-2-6-13-18)15-17-11-7-8-14-20(17)29-23(28)16-9-3-1-4-10-16/h1-15H,(H,24,26)/b19-15+ |
| InChIKey | LGMYBJHMEHBLQQ-XDJHFCHBSA-N |
| XLogP | 3.37 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|