C18H14N2O5 — CID 954211
2-[2-[(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]phenoxy]acetic acid (PubChem CID 954211) has the molecular formula C18H14N2O5 and a molecular weight of 338.32 g/mol. Its IUPAC name is 2-[2-[(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]phenoxy]acetic acid.
| Compound Name | 2-[2-[(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 954211 |
| Molecular Formula | C18H14N2O5 |
| Molecular Weight | 338.32 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 2-[2-[(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccccc1C=C1C(=O)NN(c2ccccc2)C1=O |
| InChI | InChI=1S/C18H14N2O5/c21-16(22)11-25-15-9-5-4-6-12(15)10-14-17(23)19-20(18(14)24)13-7-2-1-3-8-13/h1-10H,11H2,(H,19,23)(H,21,22) |
| InChIKey | WETAYHSNUOABMC-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.32 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|