C20H17BrN2O5 — CID 1016366
ethyl 2-[2-[(Z)-[1-(4-bromophenyl)-3,5-dioxopyrazolidin-4-ylidene]methyl]phenoxy]acetate (PubChem CID 1016366) has the molecular formula C20H17BrN2O5 and a molecular weight of 445.27 g/mol. Its IUPAC name is ethyl 2-[2-[(Z)-[1-(4-bromophenyl)-3,5-dioxopyrazolidin-4-ylidene]methyl]phenoxy]acetate.
| Compound Name | ethyl 2-[2-[(Z)-[1-(4-bromophenyl)-3,5-dioxopyrazolidin-4-ylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 1016366 |
| Molecular Formula | C20H17BrN2O5 |
| Molecular Weight | 445.27 g/mol |
| Exact Mass | 444.03 |
| IUPAC Name | ethyl 2-[2-[(Z)-[1-(4-bromophenyl)-3,5-dioxopyrazolidin-4-ylidene]methyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccccc1/C=C1/C(=O)NN(c2ccc(Br)cc2)C1=O |
| InChI | InChI=1S/C20H17BrN2O5/c1-2-27-18(24)12-28-17-6-4-3-5-13(17)11-16-19(25)22-23(20(16)26)15-9-7-14(21)8-10-15/h3-11H,2,12H2,1H3,(H,22,25)/b16-11- |
| InChIKey | MUJBDDJRBQDMFN-WJDWOHSUSA-N |
| XLogP | 2.85 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.27 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|