C20H17ClN2O5 — CID 3951825
ethyl 2-[2-chloro-4-[(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]phenoxy]acetate (PubChem CID 3951825) has the molecular formula C20H17ClN2O5 and a molecular weight of 400.82 g/mol. Its IUPAC name is ethyl 2-[2-chloro-4-[(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]phenoxy]acetate.
| Compound Name | ethyl 2-[2-chloro-4-[(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 3951825 |
| Molecular Formula | C20H17ClN2O5 |
| Molecular Weight | 400.82 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | ethyl 2-[2-chloro-4-[(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(C=C2C(=O)NN(c3ccccc3)C2=O)cc1Cl |
| InChI | InChI=1S/C20H17ClN2O5/c1-2-27-18(24)12-28-17-9-8-13(11-16(17)21)10-15-19(25)22-23(20(15)26)14-6-4-3-5-7-14/h3-11H,2,12H2,1H3,(H,22,25) |
| InChIKey | XZZQVXUQFPFPHO-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.82 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|