C20H16BrN3O7 — CID 124551029
ethyl 2-[4-bromo-2-[(Z)-(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]-6-nitrophenoxy]acetate (PubChem CID 124551029) has the molecular formula C20H16BrN3O7 and a molecular weight of 490.27 g/mol. Its IUPAC name is ethyl 2-[4-bromo-2-[(Z)-(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]-6-nitrophenoxy]acetate.
| Compound Name | ethyl 2-[4-bromo-2-[(Z)-(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]-6-nitrophenoxy]acetate |
|---|---|
| PubChem CID | 124551029 |
| Molecular Formula | C20H16BrN3O7 |
| Molecular Weight | 490.27 g/mol |
| Exact Mass | 489.02 |
| IUPAC Name | ethyl 2-[4-bromo-2-[(Z)-(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]-6-nitrophenoxy]acetate |
| SMILES | CCOC(=O)COc1c(/C=C2/C(=O)NN(c3ccccc3)C2=O)cc(Br)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H16BrN3O7/c1-2-30-17(25)11-31-18-12(8-13(21)10-16(18)24(28)29)9-15-19(26)22-23(20(15)27)14-6-4-3-5-7-14/h3-10H,2,11H2,1H3,(H,22,26)/b15-9- |
| InChIKey | LFKAKKCDHFWOEH-DHDCSXOGSA-N |
| XLogP | 2.76 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.27 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|