C19H14BrN3O7 — CID 4691061
2-[4-bromo-2-[(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]-6-nitrophenoxy]propanoic acid (PubChem CID 4691061) has the molecular formula C19H14BrN3O7 and a molecular weight of 476.24 g/mol. Its IUPAC name is 2-[4-bromo-2-[(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]-6-nitrophenoxy]propanoic acid.
| Compound Name | 2-[4-bromo-2-[(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]-6-nitrophenoxy]propanoic acid |
|---|---|
| PubChem CID | 4691061 |
| Molecular Formula | C19H14BrN3O7 |
| Molecular Weight | 476.24 g/mol |
| Exact Mass | 475.00 |
| IUPAC Name | 2-[4-bromo-2-[(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]-6-nitrophenoxy]propanoic acid |
| SMILES | CC(Oc1c(C=C2C(=O)NN(c3ccccc3)C2=O)cc(Br)cc1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C19H14BrN3O7/c1-10(19(26)27)30-16-11(7-12(20)9-15(16)23(28)29)8-14-17(24)21-22(18(14)25)13-5-3-2-4-6-13/h2-10H,1H3,(H,21,24)(H,26,27) |
| InChIKey | JGTRCIOOCILPJZ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 139.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.24 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|