C19H14Cl2N2O5 — CID 124552017
(2S)-2-[2,6-dichloro-4-[(Z)-(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]phenoxy]propanoic acid (PubChem CID 124552017) has the molecular formula C19H14Cl2N2O5 and a molecular weight of 421.24 g/mol. Its IUPAC name is (2S)-2-[2,6-dichloro-4-[(Z)-(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]phenoxy]propanoic acid.
| Compound Name | (2S)-2-[2,6-dichloro-4-[(Z)-(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 124552017 |
| Molecular Formula | C19H14Cl2N2O5 |
| Molecular Weight | 421.24 g/mol |
| Exact Mass | 420.03 |
| IUPAC Name | (2S)-2-[2,6-dichloro-4-[(Z)-(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]phenoxy]propanoic acid |
| SMILES | C[C@H](Oc1c(Cl)cc(/C=C2/C(=O)NN(c3ccccc3)C2=O)cc1Cl)C(=O)O |
| InChI | InChI=1S/C19H14Cl2N2O5/c1-10(19(26)27)28-16-14(20)8-11(9-15(16)21)7-13-17(24)22-23(18(13)25)12-5-3-2-4-6-12/h2-10H,1H3,(H,22,24)(H,26,27)/b13-7-/t10-/m0/s1 |
| InChIKey | GDHAUBSEAWKPAY-BNDQCTAISA-N |
| XLogP | 3.31 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.24 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|