C21H18ClN3O7 — CID 4541902
propan-2-yl 2-[2-chloro-4-[(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]-6-nitrophenoxy]acetate (PubChem CID 4541902) has the molecular formula C21H18ClN3O7 and a molecular weight of 459.84 g/mol. Its IUPAC name is propan-2-yl 2-[2-chloro-4-[(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]-6-nitrophenoxy]acetate.
| Compound Name | propan-2-yl 2-[2-chloro-4-[(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]-6-nitrophenoxy]acetate |
|---|---|
| PubChem CID | 4541902 |
| Molecular Formula | C21H18ClN3O7 |
| Molecular Weight | 459.84 g/mol |
| Exact Mass | 459.08 |
| IUPAC Name | propan-2-yl 2-[2-chloro-4-[(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]-6-nitrophenoxy]acetate |
| SMILES | CC(C)OC(=O)COc1c(Cl)cc(C=C2C(=O)NN(c3ccccc3)C2=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H18ClN3O7/c1-12(2)32-18(26)11-31-19-16(22)9-13(10-17(19)25(29)30)8-15-20(27)23-24(21(15)28)14-6-4-3-5-7-14/h3-10,12H,11H2,1-2H3,(H,23,27) |
| InChIKey | BWNCQDQBKPCHHL-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.84 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|