C25H19Cl2N3O4 — CID 4681227
2-[2,6-dichloro-4-[(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]phenoxy]-N-(4-methylphenyl)acetamide (PubChem CID 4681227) has the molecular formula C25H19Cl2N3O4 and a molecular weight of 496.35 g/mol. Its IUPAC name is 2-[2,6-dichloro-4-[(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]phenoxy]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[2,6-dichloro-4-[(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]phenoxy]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 4681227 |
| Molecular Formula | C25H19Cl2N3O4 |
| Molecular Weight | 496.35 g/mol |
| Exact Mass | 495.08 |
| IUPAC Name | 2-[2,6-dichloro-4-[(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]phenoxy]-N-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)COc2c(Cl)cc(C=C3C(=O)NN(c4ccccc4)C3=O)cc2Cl)cc1 |
| InChI | InChI=1S/C25H19Cl2N3O4/c1-15-7-9-17(10-8-15)28-22(31)14-34-23-20(26)12-16(13-21(23)27)11-19-24(32)29-30(25(19)33)18-5-3-2-4-6-18/h2-13H,14H2,1H3,(H,28,31)(H,29,32) |
| InChIKey | MMASLQRYCVUYDO-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.35 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|