C18H13N3O7 — CID 4210151
2-[4-[(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]-2-nitrophenoxy]acetic acid (PubChem CID 4210151) has the molecular formula C18H13N3O7 and a molecular weight of 383.32 g/mol. Its IUPAC name is 2-[4-[(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]-2-nitrophenoxy]acetic acid.
| Compound Name | 2-[4-[(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]-2-nitrophenoxy]acetic acid |
|---|---|
| PubChem CID | 4210151 |
| Molecular Formula | C18H13N3O7 |
| Molecular Weight | 383.32 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | 2-[4-[(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]-2-nitrophenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(C=C2C(=O)NN(c3ccccc3)C2=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H13N3O7/c22-16(23)10-28-15-7-6-11(9-14(15)21(26)27)8-13-17(24)19-20(18(13)25)12-4-2-1-3-5-12/h1-9H,10H2,(H,19,24)(H,22,23) |
| InChIKey | XBPLURCWLRPCQH-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 139.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.32 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|