C17H12BrN3O5 — CID 2850457
1-(4-bromophenyl)-4-[(4-methoxy-3-nitrophenyl)methylidene]pyrazolidine-3,5-dione (PubChem CID 2850457) has the molecular formula C17H12BrN3O5 and a molecular weight of 418.20 g/mol. Its IUPAC name is 1-(4-bromophenyl)-4-[(4-methoxy-3-nitrophenyl)methylidene]pyrazolidine-3,5-dione.
| Compound Name | 1-(4-bromophenyl)-4-[(4-methoxy-3-nitrophenyl)methylidene]pyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 2850457 |
| Molecular Formula | C17H12BrN3O5 |
| Molecular Weight | 418.20 g/mol |
| Exact Mass | 417.00 |
| IUPAC Name | 1-(4-bromophenyl)-4-[(4-methoxy-3-nitrophenyl)methylidene]pyrazolidine-3,5-dione |
| SMILES | COc1ccc(C=C2C(=O)NN(c3ccc(Br)cc3)C2=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H12BrN3O5/c1-26-15-7-2-10(9-14(15)21(24)25)8-13-16(22)19-20(17(13)23)12-5-3-11(18)4-6-12/h2-9H,1H3,(H,19,22) |
| InChIKey | KHIZGHQCCYAOAY-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.20 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|