C23H15N3O6 — CID 3552986
[2-[(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]-6-nitrophenyl] benzoate (PubChem CID 3552986) has the molecular formula C23H15N3O6 and a molecular weight of 429.39 g/mol. Its IUPAC name is [2-[(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]-6-nitrophenyl] benzoate.
| Compound Name | [2-[(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]-6-nitrophenyl] benzoate |
|---|---|
| PubChem CID | 3552986 |
| Molecular Formula | C23H15N3O6 |
| Molecular Weight | 429.39 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | [2-[(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]-6-nitrophenyl] benzoate |
| SMILES | O=C1NN(c2ccccc2)C(=O)C1=Cc1cccc([N+](=O)[O-])c1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C23H15N3O6/c27-21-18(22(28)25(24-21)17-11-5-2-6-12-17)14-16-10-7-13-19(26(30)31)20(16)32-23(29)15-8-3-1-4-9-15/h1-14H,(H,24,27) |
| InChIKey | APRRSHBNUXEUMB-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.39 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|