C24H17FN4O6 — CID 3616256
2-[2-[(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]-6-nitrophenoxy]-N-(3-fluorophenyl)acetamide (PubChem CID 3616256) has the molecular formula C24H17FN4O6 and a molecular weight of 476.42 g/mol. Its IUPAC name is 2-[2-[(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]-6-nitrophenoxy]-N-(3-fluorophenyl)acetamide.
| Compound Name | 2-[2-[(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]-6-nitrophenoxy]-N-(3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 3616256 |
| Molecular Formula | C24H17FN4O6 |
| Molecular Weight | 476.42 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | 2-[2-[(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]-6-nitrophenoxy]-N-(3-fluorophenyl)acetamide |
| SMILES | O=C(COc1c(C=C2C(=O)NN(c3ccccc3)C2=O)cccc1[N+](=O)[O-])Nc1cccc(F)c1 |
| InChI | InChI=1S/C24H17FN4O6/c25-16-7-5-8-17(13-16)26-21(30)14-35-22-15(6-4-11-20(22)29(33)34)12-19-23(31)27-28(24(19)32)18-9-2-1-3-10-18/h1-13H,14H2,(H,26,30)(H,27,31) |
| InChIKey | KLYIXPUSSWDLTE-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.42 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|