C25H15Br2N3O6 — CID 126410739
[2,4-dibromo-6-[(E)-(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]phenyl] (E)-3-(4-nitrophenyl)prop-2-enoate (PubChem CID 126410739) has the molecular formula C25H15Br2N3O6 and a molecular weight of 613.22 g/mol. Its IUPAC name is [2,4-dibromo-6-[(E)-(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]phenyl] (E)-3-(4-nitrophenyl)prop-2-enoate.
| Compound Name | [2,4-dibromo-6-[(E)-(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]phenyl] (E)-3-(4-nitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 126410739 |
| Molecular Formula | C25H15Br2N3O6 |
| Molecular Weight | 613.22 g/mol |
| Exact Mass | 610.93 |
| IUPAC Name | [2,4-dibromo-6-[(E)-(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]phenyl] (E)-3-(4-nitrophenyl)prop-2-enoate |
| SMILES | O=C(/C=C/c1ccc([N+](=O)[O-])cc1)Oc1c(Br)cc(Br)cc1/C=C1\C(=O)NN(c2ccccc2)C1=O |
| InChI | InChI=1S/C25H15Br2N3O6/c26-17-12-16(13-20-24(32)28-29(25(20)33)18-4-2-1-3-5-18)23(21(27)14-17)36-22(31)11-8-15-6-9-19(10-7-15)30(34)35/h1-14H,(H,28,32)/b11-8+,20-13+ |
| InChIKey | BPWJEWKTYFFMEK-DFMPKFEDSA-N |
| XLogP | 5.20 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.22 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|