C25H16BrClN2O4 — CID 126411632
[4-bromo-2-[(E)-(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]phenyl] (E)-3-(4-chlorophenyl)prop-2-enoate (PubChem CID 126411632) has the molecular formula C25H16BrClN2O4 and a molecular weight of 523.77 g/mol. Its IUPAC name is [4-bromo-2-[(E)-(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]phenyl] (E)-3-(4-chlorophenyl)prop-2-enoate.
| Compound Name | [4-bromo-2-[(E)-(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]phenyl] (E)-3-(4-chlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 126411632 |
| Molecular Formula | C25H16BrClN2O4 |
| Molecular Weight | 523.77 g/mol |
| Exact Mass | 522.00 |
| IUPAC Name | [4-bromo-2-[(E)-(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]phenyl] (E)-3-(4-chlorophenyl)prop-2-enoate |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1)Oc1ccc(Br)cc1/C=C1\C(=O)NN(c2ccccc2)C1=O |
| InChI | InChI=1S/C25H16BrClN2O4/c26-18-9-12-22(33-23(30)13-8-16-6-10-19(27)11-7-16)17(14-18)15-21-24(31)28-29(25(21)32)20-4-2-1-3-5-20/h1-15H,(H,28,31)/b13-8+,21-15+ |
| InChIKey | DRBNLRKUWILYGO-LBOBZYTGSA-N |
| XLogP | 5.18 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.77 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|