C21H13BrN2O5 — CID 5039815
[4-bromo-2-[(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]phenyl] furan-2-carboxylate (PubChem CID 5039815) has the molecular formula C21H13BrN2O5 and a molecular weight of 453.25 g/mol. Its IUPAC name is [4-bromo-2-[(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]phenyl] furan-2-carboxylate.
| Compound Name | [4-bromo-2-[(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]phenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 5039815 |
| Molecular Formula | C21H13BrN2O5 |
| Molecular Weight | 453.25 g/mol |
| Exact Mass | 452.00 |
| IUPAC Name | [4-bromo-2-[(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]phenyl] furan-2-carboxylate |
| SMILES | O=C1NN(c2ccccc2)C(=O)C1=Cc1cc(Br)ccc1OC(=O)c1ccco1 |
| InChI | InChI=1S/C21H13BrN2O5/c22-14-8-9-17(29-21(27)18-7-4-10-28-18)13(11-14)12-16-19(25)23-24(20(16)26)15-5-2-1-3-6-15/h1-12H,(H,23,25) |
| InChIKey | UHWMQSFOGHSWKY-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.25 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|