C23H13Cl3N2O4 — CID 4237659
[4-chloro-2-[(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]phenyl] 2,4-dichlorobenzoate (PubChem CID 4237659) has the molecular formula C23H13Cl3N2O4 and a molecular weight of 487.73 g/mol. Its IUPAC name is [4-chloro-2-[(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]phenyl] 2,4-dichlorobenzoate.
| Compound Name | [4-chloro-2-[(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]phenyl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 4237659 |
| Molecular Formula | C23H13Cl3N2O4 |
| Molecular Weight | 487.73 g/mol |
| Exact Mass | 485.99 |
| IUPAC Name | [4-chloro-2-[(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]phenyl] 2,4-dichlorobenzoate |
| SMILES | O=C1NN(c2ccccc2)C(=O)C1=Cc1cc(Cl)ccc1OC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H13Cl3N2O4/c24-14-7-9-20(32-23(31)17-8-6-15(25)12-19(17)26)13(10-14)11-18-21(29)27-28(22(18)30)16-4-2-1-3-5-16/h1-12H,(H,27,29) |
| InChIKey | PZPWAVZUTFUFJW-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.73 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|