C21H12BrNO5 — CID 2896757
[4-bromo-2-[(5-oxo-2-phenyl-1,3-oxazol-4-ylidene)methyl]phenyl] furan-2-carboxylate (PubChem CID 2896757) has the molecular formula C21H12BrNO5 and a molecular weight of 438.23 g/mol. Its IUPAC name is [4-bromo-2-[(5-oxo-2-phenyl-1,3-oxazol-4-ylidene)methyl]phenyl] furan-2-carboxylate.
| Compound Name | [4-bromo-2-[(5-oxo-2-phenyl-1,3-oxazol-4-ylidene)methyl]phenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 2896757 |
| Molecular Formula | C21H12BrNO5 |
| Molecular Weight | 438.23 g/mol |
| Exact Mass | 436.99 |
| IUPAC Name | [4-bromo-2-[(5-oxo-2-phenyl-1,3-oxazol-4-ylidene)methyl]phenyl] furan-2-carboxylate |
| SMILES | O=C1OC(c2ccccc2)=NC1=Cc1cc(Br)ccc1OC(=O)c1ccco1 |
| InChI | InChI=1S/C21H12BrNO5/c22-15-8-9-17(27-21(25)18-7-4-10-26-18)14(11-15)12-16-20(24)28-19(23-16)13-5-2-1-3-6-13/h1-12H |
| InChIKey | YMJXAPZXVJGQHH-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 78.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.23 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|