C28H24BrNO6 — CID 126196972
[4-bromo-2-[(Z)-[2-(3,4-diethoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 4-methylbenzoate (PubChem CID 126196972) has the molecular formula C28H24BrNO6 and a molecular weight of 550.41 g/mol. Its IUPAC name is [4-bromo-2-[(Z)-[2-(3,4-diethoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 4-methylbenzoate.
| Compound Name | [4-bromo-2-[(Z)-[2-(3,4-diethoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 126196972 |
| Molecular Formula | C28H24BrNO6 |
| Molecular Weight | 550.41 g/mol |
| Exact Mass | 549.08 |
| IUPAC Name | [4-bromo-2-[(Z)-[2-(3,4-diethoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 4-methylbenzoate |
| SMILES | CCOc1ccc(C2=N/C(=C\c3cc(Br)ccc3OC(=O)c3ccc(C)cc3)C(=O)O2)cc1OCC |
| InChI | InChI=1S/C28H24BrNO6/c1-4-33-24-12-10-19(16-25(24)34-5-2)26-30-22(28(32)36-26)15-20-14-21(29)11-13-23(20)35-27(31)18-8-6-17(3)7-9-18/h6-16H,4-5H2,1-3H3/b22-15- |
| InChIKey | QHVLJTKIWWMVFP-JCMHNJIXSA-N |
| XLogP | 6.12 |
| TPSA | 83.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.41 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|