C25H21NO7 — CID 126195545
[2-[(Z)-[2-(3,4-diethoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] furan-2-carboxylate (PubChem CID 126195545) has the molecular formula C25H21NO7 and a molecular weight of 447.44 g/mol. Its IUPAC name is [2-[(Z)-[2-(3,4-diethoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] furan-2-carboxylate.
| Compound Name | [2-[(Z)-[2-(3,4-diethoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 126195545 |
| Molecular Formula | C25H21NO7 |
| Molecular Weight | 447.44 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | [2-[(Z)-[2-(3,4-diethoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] furan-2-carboxylate |
| SMILES | CCOc1ccc(C2=N/C(=C\c3ccccc3OC(=O)c3ccco3)C(=O)O2)cc1OCC |
| InChI | InChI=1S/C25H21NO7/c1-3-29-20-12-11-17(15-22(20)30-4-2)23-26-18(24(27)33-23)14-16-8-5-6-9-19(16)32-25(28)21-10-7-13-31-21/h5-15H,3-4H2,1-2H3/b18-14- |
| InChIKey | PDCPHZGYHLSSSU-JXAWBTAJSA-N |
| XLogP | 4.64 |
| TPSA | 96.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.44 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|