C27H25BrN2O4 — CID 46497812
(4Z)-4-[[5-bromo-2-[2-(3-ethyl-5-methylphenoxy)ethoxy]phenyl]methylidene]-1-phenylpyrazolidine-3,5-dione (PubChem CID 46497812) has the molecular formula C27H25BrN2O4 and a molecular weight of 521.41 g/mol. Its IUPAC name is (4Z)-4-[[5-bromo-2-[2-(3-ethyl-5-methylphenoxy)ethoxy]phenyl]methylidene]-1-phenylpyrazolidine-3,5-dione.
| Compound Name | (4Z)-4-[[5-bromo-2-[2-(3-ethyl-5-methylphenoxy)ethoxy]phenyl]methylidene]-1-phenylpyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 46497812 |
| Molecular Formula | C27H25BrN2O4 |
| Molecular Weight | 521.41 g/mol |
| Exact Mass | 520.10 |
| IUPAC Name | (4Z)-4-[[5-bromo-2-[2-(3-ethyl-5-methylphenoxy)ethoxy]phenyl]methylidene]-1-phenylpyrazolidine-3,5-dione |
| SMILES | CCc1cc(C)cc(OCCOc2ccc(Br)cc2/C=C2/C(=O)NN(c3ccccc3)C2=O)c1 |
| InChI | InChI=1S/C27H25BrN2O4/c1-3-19-13-18(2)14-23(15-19)33-11-12-34-25-10-9-21(28)16-20(25)17-24-26(31)29-30(27(24)32)22-7-5-4-6-8-22/h4-10,13-17H,3,11-12H2,1-2H3,(H,29,31)/b24-17- |
| InChIKey | KKQNUMWVFRIFFS-ULJHMMPZSA-N |
| XLogP | 5.24 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.41 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|